CAS 26482-53-1
:2-tricyclo[3.3.1.1~3,7~]dec-1-ylethanaminium
Description:
2-Tricyclo[3.3.1.1^3,7]dec-1-ylethanaminium, with the CAS number 26482-53-1, is a quaternary ammonium compound characterized by its unique bicyclic structure. This compound features a tricyclic framework, which contributes to its rigidity and steric hindrance, influencing its reactivity and interactions with other molecules. As a quaternary ammonium salt, it typically exhibits properties such as solubility in polar solvents and the ability to act as a surfactant or antimicrobial agent. The presence of the ammonium group imparts cationic characteristics, making it potentially useful in various applications, including as a phase transfer catalyst or in biological systems. Its structural complexity may also lead to interesting conformational behavior and potential applications in materials science or drug development. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, 2-tricyclo[3.3.1.1^3,7]dec-1-ylethanaminium represents a fascinating example of synthetic organic chemistry with potential utility in diverse fields.
Formula:C12H22N
InChI:InChI=1/C12H21N/c13-2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,1-8,13H2/p+1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(2-Aminoethyl)adamantane
CAS:Adamantane is a small molecule that can be used in diagnosis. It is a potent inhibitor of serine proteases and has been used as a model for the study of these enzymes. Adamantane binds to the active site of serine proteases, forming an intramolecular hydrogen bond with the catalytic serine residue. Adamantane inhibits in vitro the activity of pepsin, chymotrypsin, and trypsin. The inhibition of chymotrypsin by adamantane has been shown to be selective over other serine proteases. Adamantane can also inhibit lysosomal phospholipase A2 (LP-PLA2) activity, which may lead to diagnostic applications for neurodegenerative diseases such as Alzheimer's disease or Parkinson's disease.
Formula:C12H21NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:179.3 g/mol

