CAS 2649-64-1
:Clovanediol
Description:
Clovanediol, identified by its CAS number 2649-64-1, is a chemical compound that belongs to the class of organic compounds known as diols, which contain two hydroxyl (-OH) functional groups. This substance is characterized by its structural features, which include a bicyclic framework derived from the clovane structure. Clovanediol is typically a colorless to pale yellow liquid, exhibiting moderate solubility in water and good solubility in organic solvents. Its physical properties may include a specific boiling point and melting point, which are influenced by its molecular structure. Clovanediol is of interest in various fields, including organic synthesis and potentially in the development of fragrances or flavoring agents due to its unique chemical properties. Additionally, it may exhibit biological activity, making it a subject of research in medicinal chemistry. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C15H26O2
InChI:InChI=1S/C15H26O2/c1-13(2)8-12(17)15-7-5-11(16)14(3,9-15)6-4-10(13)15/h10-12,16-17H,4-9H2,1-3H3/t10-,11+,12-,14+,15-/m0/s1
InChI key:InChIKey=BWXJQHJHGMZLBT-OEMOEHNSSA-N
SMILES:O[C@@H]1[C@]23[C@](C(C)(C)C1)(CC[C@](C)(C2)[C@H](O)CC3)[H]
Synonyms:- (1S,2S,5S,8R,9R)-Clovane-2,9-diol
- (3S,3aS,6R,7R,9aS)-Decahydro-1,1,7-trimethyl-3a,7-methano-3aH-cyclopentacyclooctene-3,6-diol
- 2b,9a-Dihydroxyclovane
- 2β,9α-Clovanediol
- 3a,7-Methano-3aH-cyclopentacyclooctene-3,6-diol, decahydro-1,1,7-trimethyl-,[3S-(3a,3ab,6b,7b,9aa)]-
- 3a,7-Methano-3aH-cyclopentacyclooctene-3,6-diol,1,2,3a,4,5,6b,7,8,9,9a-decahydro-1,1,7b-trimethyl-
- Clovane-2b,9a-diol
- Clovanediol
- Cloven-2b,9a-diol
- 3a,7-Methano-3aH-cyclopentacyclooctene-3,6-diol, decahydro-1,1,7-trimethyl-, (3S,3aS,6R,7R,9aS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3a,7-Methano-3aH-cyclopentacyclooctene-3,6-diol, decahydro-1,1,7-trimethyl-, (3S,3aS,6R,7R,9aS)-
CAS:Formula:C15H26O2Purity:98.0%Molecular weight:238.3657Clovanediol
CAS:Clovanediol is a natural product of Psidium, Myrtaceae.Formula:C15H26O2Purity:98%Color and Shape:SolidMolecular weight:238.37Clovanediol
CAS:Controlled ProductApplications Clovanediol is a natural product found in cloves and other plant species.
Formula:C15H26O2Color and Shape:NeatMolecular weight:238.366Clovanediol
CAS:Clovanediol is a multifunctional antimicrobial agent, which is derived from natural clove oil. It acts by disrupting the cell membranes of microorganisms, thereby inhibiting their growth and proliferation. This mechanism of action involves penetrating microbial cell membranes, leading to the leakage of cellular contents and eventual cell death. Clovanediol is utilized primarily for its antimicrobial efficacy, making it a valuable component in a variety of applications.Formula:C15H26O2Purity:Min. 95%Molecular weight:238.37 g/mol




