CAS 264927-52-8

2-Chloro-4-fluoro-5-iodobenzoic acid

Description:

2-Chloro-4-fluoro-5-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of multiple halogen substituents on the benzene ring. This compound features a chloro group, a fluoro group, and an iodo group, which contribute to its unique chemical properties and reactivity. The presence of these halogens can significantly influence the compound's polarity, solubility, and reactivity in various chemical reactions. As a benzoic acid derivative, it possesses a carboxylic acid functional group (-COOH), which imparts acidic characteristics and allows for potential participation in acid-base reactions. The compound is likely to be solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its halogen substituents can also enhance its utility in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Overall, 2-Chloro-4-fluoro-5-iodobenzoic acid is a versatile compound with applications in various fields of chemistry.

Formula: C₇H₃ClFIO₂

InChI: InChI=1S/C7H3ClFIO2/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2H,(H,11,12)

InChI key: InChIKey=PXQFJWCRWMFMEG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Cl)C=C(F)C(I)=C1

Synonyms:

• 2-Chloro-4-fluoro-5-iodobenzoic acid
• Benzoic acid, 2-chloro-4-fluoro-5-iodo-
• 2-Chloro-4-fluoro-5-iodo-benzoic acid

Benzoic acid, 2-chloro-4-fluoro-5-iodo-

CAS: 264927-52-8

Formula: C₇H₃ClFIO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 300.4534

Ref: IN-DA002TG5

2-Chloro-4-fluoro-5-iodobenzoic acid

CAS: 264927-52-8

2-Chloro-4-fluoro-5-iodobenzoic acid

Purity: 95%

Molecular weight: 300.45g/mol

Ref: 54-PC111721

2-Chloro-4-fluoro-5-iodobenzoic acid

CAS: 264927-52-8

Formula: C₇H₃ClFIO₂

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 300.45

Ref: 10-F335799