CymitQuimica logo

CAS 2650-35-3

:

(6S,10aR)-8,9,10,10a-tetrahydro-6,10b-methanofuro[2,3-c]pyrrolo[1,2-a]azepin-2(6H)-one

Description:
The chemical substance known as (6S,10aR)-8,9,10,10a-tetrahydro-6,10b-methanofuro[2,3-c]pyrrolo[1,2-a]azepin-2(6H)-one, with the CAS number 2650-35-3, is a complex organic compound characterized by its unique bicyclic structure that incorporates both a furo and a pyrrolo moiety. This compound features multiple stereocenters, contributing to its chiral nature, which can influence its biological activity and interactions. It is typically classified as a heterocyclic compound due to the presence of nitrogen and oxygen atoms within its ring systems. The presence of the methanofuro group suggests potential reactivity and interactions with various biological targets, making it of interest in medicinal chemistry. Its structural complexity may also confer specific physicochemical properties, such as solubility and stability, which are crucial for its application in pharmaceuticals or as a research chemical. Overall, this compound exemplifies the intricate nature of organic molecules used in advanced chemical research and development.
Formula:C12H13NO2
InChI:InChI=1/C12H13NO2/c14-11-6-8-3-4-9-7-12(8,15-11)10-2-1-5-13(9)10/h3-4,6,9-10H,1-2,5,7H2/t9-,10-,12?/m1/s1
SMILES:C1C[C@@H]2C34C[C@@H](C=CC3=CC(=O)O4)N2C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.