CAS 2651-43-6

3-hydroxypropanamide

Description:

3-Hydroxypropanamide, with the CAS number 2651-43-6, is an organic compound characterized by the presence of both an amide and a hydroxyl functional group. It features a three-carbon chain with a hydroxyl group (-OH) attached to the third carbon and an amide group (-C(=O)NH2) at the end of the chain. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in water and polar organic solvents due to its ability to form hydrogen bonds. The presence of the hydroxyl group contributes to its reactivity, making it a potential intermediate in organic synthesis and pharmaceuticals. Additionally, 3-hydroxypropanamide can participate in various chemical reactions, including acylation and esterification, due to its functional groups. Its properties make it of interest in fields such as medicinal chemistry and materials science, where it may be utilized in the development of bioactive compounds or polymers.

Formula: C₃H₇NO₂

InChI: InChI=1/C3H7NO2/c4-3(6)1-2-5/h5H,1-2H2,(H2,4,6)

SMILES: C(CO)C(=N)O

Synonyms:

• Propanamide, 3-Hydroxy-

Propanamide, 3-hydroxy-

CAS: 2651-43-6

Formula: C₃H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 89.0932

Ref: IN-DA002TIP

3-Hydroxypropanamide

CAS: 2651-43-6

3-Hydroxypropanamide

Purity: 97%

Molecular weight: 89.09g/mol

Ref: 54-OR1069957

3-Hydroxypropionamide

Controlled Product

CAS: 2651-43-6

Applications 3-Hydroxypropionamide (cas# 2651-43-6) is a compound useful in organic synthesis.

Formula: C₃H₇NO₂

Color and Shape: Neat

Molecular weight: 89.09

Ref: TR-H952525

3-hydroxypropanamide

CAS: 2651-43-6

Formula: C₃H₇NO₂

Purity: 95.0%

Molecular weight: 89.094

Ref: 10-F360785