CAS 2651-55-0

3-Ethoxy-4-methoxybenzoic acid

Description:

3-Ethoxy-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of both ethoxy and methoxy functional groups attached to a benzoic acid framework. Its molecular structure features a benzene ring substituted at the 3-position with an ethoxy group and at the 4-position with a methoxy group, contributing to its unique chemical properties. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic system and alkoxy substituents. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its CAS number, 2651-55-0, is a unique identifier that facilitates the tracking and study of this specific chemical in scientific literature and regulatory databases.

Formula: C₁₀H₁₁O₄

InChI: InChI=1/C10H12O4/c1-3-14-9-6-7(10(11)12)4-5-8(9)13-2/h4-6H,3H2,1-2H3,(H,11,12)/p-1

SMILES: CCOc1cc(ccc1OC)C(=O)[O-]

Synonyms:

• 3-Ethoxy-4-Methoxybenzoate

3-Ethoxy-4-methoxybenzoic acid, 98%

CAS: 2651-55-0

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₁₀H₁₂O₄

Purity: 98%

Color and Shape: Powder, White to pale cream

Molecular weight: 196.2

Ref: 02-B20489

Benzoic acid, 3-ethoxy-4-methoxy-

CAS: 2651-55-0

Formula: C₁₀H₁₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.1999

Ref: IN-DA002TIN

3-Ethoxy-4-Methoxybenzoic Acid

CAS: 2651-55-0

3-Ethoxy-4-Methoxybenzoic Acid

Purity: 98%

Molecular weight: 196.20g/mol

Ref: 54-OR1010978

3-Ethoxy-4-methoxybenzoic acid

CAS: 2651-55-0

Formula: C₁₀H₁₂O₄

Purity: 98%(GC-MS);RG

Color and Shape: Solid

Molecular weight: 196.202

Ref: 10-F014650

3-Ethoxy-4-methoxybenzoic acid

CAS: 2651-55-0

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₄

Purity: Min. 95%

Molecular weight: 196.2 g/mol

Ref: 3D-CAA65155

Apremilast Impurity 38

CAS: 2651-55-0

Formula: C₁₀H₁₂O₄

Molecular weight: 196.2

Ref: ST-EA-CP-A77050