CAS 265126-59-8

1-{2-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-4-yl}ethanone

Description:

1-{2-[4-(Trifluoromethoxy)phenyl]-1,3-thiazol-4-yl}ethanone is a chemical compound characterized by its unique structural features, which include a thiazole ring and a trifluoromethoxy group. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The thiazole moiety contributes to the compound's potential as a heterocyclic compound, often associated with various biological activities, including antimicrobial and anti-inflammatory properties. The ethanone functional group indicates that it is a ketone, which can participate in various chemical reactions, such as nucleophilic additions. This compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by factors such as solvent choice and reaction conditions. Its molecular interactions and stability can be studied using techniques like NMR and mass spectrometry, providing insights into its potential applications in medicinal chemistry and material science. Overall, this compound represents a class of molecules that may have significant implications in drug development and chemical research.

Formula: C₁₂H₈F₃NO₂S

InChI: InChI=1/C12H8F3NO2S/c1-7(17)10-6-19-11(16-10)8-2-4-9(5-3-8)18-12(13,14)15/h2-6H,1H3

SMILES: CC(=O)c1csc(c2ccc(cc2)OC(F)(F)F)n1

Synonyms:

• 1-{2-[4-(Trifluoromethoxy)Phenyl]-1,3-Thiazol-4-Yl}Ethan-1-One

1-[2-(4-Trifluoromethoxy-phenyl)-thiazol-4-yl]-ethanone

CAS: 265126-59-8

Formula: C₁₂H₈F₃NO₂S

Molecular weight: 287.2576

Ref: IN-DA002TIW

1-[2-(4-Trifluoromethoxy-phenyl)-thiazol-4-yl]-ethanone

CAS: 265126-59-8

1-[2-(4-Trifluoromethoxy-phenyl)-thiazol-4-yl]-ethanone

Purity: 95%

Molecular weight: 287.26g/mol

Ref: 54-PC104181

1-[2-(4-Trifluoromethoxy-phenyl)-thiazol-4-yl]-ethanone

CAS: 265126-59-8

Formula: C₁₂H₈F₃NO₂S

Purity: 95.0%

Molecular weight: 287.26

Ref: 10-F475633