
CAS 26513-79-1
:2,3-Dihydro-3-oxo-4H-1,4-benzoxazine-4-acetamide
Description:
2,3-Dihydro-3-oxo-4H-1,4-benzoxazine-4-acetamide, with the CAS number 26513-79-1, is a heterocyclic organic compound characterized by its benzoxazine structure, which includes a fused benzene and oxazine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. It is known for its potential applications in various fields, including pharmaceuticals and materials science, due to its unique chemical properties. The presence of the acetamide functional group contributes to its reactivity and potential biological activity. Additionally, the compound may exhibit interesting thermal and mechanical properties, making it suitable for use in polymer formulations. Its synthesis often involves cyclization reactions, and it may serve as an intermediate in the production of more complex molecules. As with many chemical substances, safety precautions should be observed when handling it, and its environmental impact should be assessed in accordance with regulatory guidelines.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c11-9(13)5-12-7-3-1-2-4-8(7)15-6-10(12)14/h1-4H,5-6H2,(H2,11,13)
InChI key:InChIKey=ZHDATZMWGSUDMP-UHFFFAOYSA-N
SMILES:C(C(N)=O)N1C=2C(OCC1=O)=CC=CC2
Synonyms:- 2-(3-Oxo-3,4-dihydro-2H-1,4-benzoxazin-4-yl)acetamide
- Paraxazone
- 4H-1,4-Benzoxazine-4-acetamide, 2,3-dihydro-3-oxo-
- 2,3-Dihydro-3-oxo-4H-1,4-benzoxazine-4-acetamide
- 2-(3-Oxo-2H-benzo[b][1,4]oxazin-4(3H)-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Paraxazone
CAS:Paraxazone is an antidepressant. It acts as a reversible inhibitor of the enzyme monoamine oxidase.Formula:C10H10N2O3Color and Shape:SolidMolecular weight:206.2
