CAS 265130-17-4
:2,3-dichloro-N-hydroxybenzenecarboximidoyl chloride
Description:
2,3-Dichloro-N-hydroxybenzenecarboximidoyl chloride is a chemical compound characterized by its unique functional groups and structural features. It contains a benzene ring substituted with two chlorine atoms at the 2 and 3 positions, a hydroxyl group, and an imidoyl chloride functional group. This compound is typically used in organic synthesis, particularly in the preparation of various derivatives due to its reactive imidoyl chloride moiety, which can participate in nucleophilic substitution reactions. The presence of the hydroxyl group may also influence its reactivity and solubility in polar solvents. As a chlorinated compound, it may exhibit specific properties such as increased stability and potential toxicity, necessitating careful handling and storage. Additionally, its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups are often integral to biological activity. Overall, 2,3-dichloro-N-hydroxybenzenecarboximidoyl chloride is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C7H4Cl3NO
InChI:InChI=1/C7H4Cl3NO/c8-5-3-1-2-4(6(5)9)7(10)11-12/h1-3,12H
SMILES:c1cc(c(c(c1)Cl)Cl)C(=NO)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzenecarboximidoyl chloride, 2,3-dichloro-N-hydroxy-
CAS:Formula:C7H4Cl3NOMolecular weight:224.47181,2',3'-Trichlorobenzaldoxime
CAS:1,2',3'-TrichlorobenzaldoximePurity:techMolecular weight:224.47g/mol

