CAS 26519-91-5
:Methylcyclopentadiene
Description:
Methylcyclopentadiene, with the CAS number 26519-91-5, is an organic compound characterized by its cyclic structure and the presence of both a methyl group and a diene system. It features a five-membered cyclopentadiene ring with a methyl substituent, which influences its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid at room temperature and has a distinctive odor. Methylcyclopentadiene is known for its ability to undergo various chemical reactions, including Diels-Alder reactions, due to the presence of conjugated double bonds. Its molecular formula is C6H8, and it exhibits properties typical of unsaturated hydrocarbons, such as lower boiling points compared to saturated counterparts. The compound is used in organic synthesis and as an intermediate in the production of various chemicals, including polymers and specialty chemicals. Additionally, it is important in the field of materials science for its role in the synthesis of certain types of resins and elastomers.
Formula:C6H8
InChI:InChI=1/C12H19N/c1-9(13)10-5-7-11(8-6-10)12(2,3)4/h5-9H,13H2,1-4H3/t9-/m0/s1
SMILES:C[C@@H](c1ccc(cc1)C(C)(C)C)N
Synonyms:- (1S)-1-(4-tert-butylphenyl)ethanamine
- 1,3-Cyclopentadiene, methyl-
- 1-Methylcyclopenta-1,3-Diene
- Cyclopentadiene, methyl-
- Mcpd
- Methyl-1,3-cyclopentadiene
- Methylcyclopentadiene
- Monomethylcyclopentadiene
- methylcyclopenta-1,3-diene
- 1-METHYLCYCLOPENTADIENE
- METHYL-1,3-CYCLOPENTADIENEDIMER
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.