CAS 2653-39-6: 2-[(4-Ethenylphenoxy)methyl]oxirane

Description:2-[(4-Ethenylphenoxy)methyl]oxirane, also known by its CAS number 2653-39-6, is an organic compound characterized by the presence of an epoxide functional group, which is a three-membered cyclic ether. This compound features a phenoxy group attached to a vinyl-substituted aromatic ring, contributing to its reactivity and potential applications in polymer chemistry and as a monomer in the synthesis of various materials. The epoxide structure is known for its ability to undergo ring-opening reactions, making it useful in cross-linking and curing processes. Additionally, the presence of the vinyl group suggests that it can participate in further polymerization reactions, enhancing its utility in producing copolymers or as a reactive diluent. The compound is typically colorless to pale yellow and may have a characteristic odor. Its properties, such as solubility and stability, can vary depending on the solvent and environmental conditions. Safety precautions should be taken when handling this compound, as epoxides can be irritants and potentially hazardous.

Formula:C₁₁H₁₂O₂

InChI:InChI=1S/C11H12O2/c1-2-9-3-5-10(6-4-9)12-7-11-8-13-11/h2-6,11H,1,7-8H2

InChI key:InChIKey=AAUXVPAKDMCMMN-UHFFFAOYSA-N

SMILES:O(C1=CC=C(C=C)C=C1)CC2OC2