CymitQuimica logo

CAS 26530-93-8

:

1-methyl-1H-benzimidazol-6-amine

Description:
1-Methyl-1H-benzimidazol-6-amine, with the CAS number 26530-93-8, is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a methyl group at the nitrogen atom in the 1-position and an amino group at the 6-position of the benzimidazole ring. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, including antimicrobial and anticancer properties. Its structure allows for interactions with biological targets, making it a candidate for further research in drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H9N3
InChI:InChI=1/C8H9N3/c1-11-5-10-7-3-2-6(9)4-8(7)11/h2-5H,9H2,1H3
InChI key:AYZALFCBEKQGRT-UHFFFAOYSA-N
SMILES:Cn1cnc2ccc(cc12)N
Synonyms:
  • 1H-benzimidazol-6-amine, 1-methyl-
Found 4 products.