CymitQuimica logo

CAS 265330-98-1

:

bromo(5-ethoxy-5-oxopentyl)zinc

Description:
Bromo(5-ethoxy-5-oxopentyl)zinc, with the CAS number 265330-98-1, is an organozinc compound that typically features a zinc atom coordinated to a bromoalkyl group and an ethoxy-oxopentyl moiety. This compound is characterized by its reactivity, particularly in organic synthesis, where it can serve as a nucleophile in various coupling reactions, such as cross-coupling and alkylation processes. The presence of the bromo group enhances its electrophilic character, making it suitable for reactions with electrophiles. The ethoxy and oxo functional groups contribute to its solubility in organic solvents and can influence its reactivity and stability. Additionally, organozinc compounds are known for their ability to participate in carbon-carbon bond formation, making them valuable intermediates in the synthesis of complex organic molecules. Safety considerations should be taken into account when handling this compound, as organozinc reagents can be sensitive to moisture and air, potentially leading to hazardous reactions. Overall, bromo(5-ethoxy-5-oxopentyl)zinc is a versatile reagent in synthetic organic chemistry.
Formula:C7H13BrO2Zn
InChI:InChI=1/C7H13O2.BrH.Zn/c1-3-5-6-7(8)9-4-2;;/h1,3-6H2,2H3;1H;/q;;+1/p-1/rC7H13BrO2Zn/c1-2-10-7(9)5-3-4-6-11-8/h2-6H2,1H3
SMILES:[CH2]CCCC(=O)OCC.Br.[Zn]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.