CAS 26537-68-8

1-benzofuran-3-carboxylic acid

Description:

1-Benzofuran-3-carboxylic acid is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features a carboxylic acid functional group (-COOH) at the 3-position of the benzofuran ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows for potential reactivity in various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure allows for various applications in organic synthesis and materials science. As with many organic compounds, proper handling and storage are essential to maintain stability and prevent degradation. Safety data sheets should be consulted for information on toxicity and safe handling practices.

Formula: C₉H₆O₃

InChI: InChI=1/C9H6O3/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H,(H,10,11)

SMILES: c1ccc2c(c1)c(co2)C(=O)O

Synonyms:

• 3-Benzofurancarboxylic Acid

3-Benzofurancarboxylic acid

CAS: 26537-68-8

Formula: C₉H₆O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.1421

Ref: IN-DA002TLL

Benzo[b]furan-3-carboxylic acid

CAS: 26537-68-8

Benzo[b]furan-3-carboxylic acid

Formula: C₉H₆O₃

Purity: 95%

Color and Shape: white solid

Molecular weight: 162.14g/mol

Ref: 54-OR16562

Benzofuran-3-carboxylic acid

CAS: 26537-68-8

Formula: C₉H₆O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.144

Ref: 10-F216652

Benzofuran-3-carboxylic acid

CAS: 26537-68-8

Benzofuran-3-carboxylic acid is a furan derivative with an acetyl group at the 3 position. It is used as a fungicide and has significant antifungal activity against Cryptococcus neoformans. Benzofuran-3-carboxylic acid inhibits the growth of C. neoformans by binding to its cell membrane and disrupting its function, inhibiting protein synthesis and cytoplasmic membrane function. Benzofuran-3-carboxylic acid also inhibits the production of reactive oxygen species (ROS) in cells, which may be due to its ability to inhibit phospholipase A2. This compound has been shown to have an affinity for both benzoyl derivatives and ethyl diazoacetate molecules, which can be used for molecular docking studies on the effects of this molecule on cellular functions.

Formula: C₉H₆O₃

Purity: Min. 95%

Molecular weight: 162.14 g/mol

Ref: 3D-BBA53768