CAS 26539-01-5
:3-(3,5-Dihydroxyphenyl)-1-propanoic acid
Description:
3-(3,5-Dihydroxyphenyl)-1-propanoic acid, also known as dihydroxyphenylpropanoic acid, is an organic compound characterized by its phenolic structure and carboxylic acid functional group. It features a propanoic acid backbone attached to a phenyl ring that has two hydroxyl groups at the 3 and 5 positions, contributing to its potential antioxidant properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of hydroxyl groups, which can form hydrogen bonds. Its molecular structure allows for various interactions, making it of interest in biochemical research, particularly in studies related to its potential health benefits, such as anti-inflammatory and antioxidant effects. Additionally, it may play a role in the synthesis of other chemical compounds or serve as a precursor in organic synthesis. As with many phenolic compounds, it may exhibit varying degrees of stability and reactivity depending on environmental conditions.
Formula:C9H10O4
InChI:InChI=1S/C9H10O4/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h3-5,10-11H,1-2H2,(H,12,13)
InChI key:InChIKey=ITPFIKQWNDGDLG-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=CC(O)=CC(O)=C1
Synonyms:- 3,5-Dihydroxybenzenepropanoic acid
- 3,5-Dihydroxyhydrocinnamic acid
- 3-(3,5-Dihydroxyphenyl)-1-propanoic acid
- Benzenepropanoic Acid, 3,5-Dihydroxy-
- Hydrocinnamic acid, 3,5-dihydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(3,5-Dihydroxyphenyl)propanoic acid
CAS:Formula:C9H10O4Color and Shape:SolidMolecular weight:182.17333-(3,5-Dihydroxyphenyl)-1-propanoic Acid
CAS:Controlled ProductFormula:C9H10O4Color and Shape:Off-WhiteMolecular weight:182.173-(3,5-Dihydroxyphenyl)-1-propanoic acid
CAS:3-(3,5-Dihydroxyphenyl)-1-propanoic acid is a metabolite of 3,5-dihydroxybenzoic acid (DHBA) that has been found to be elevated in the urine of women with breast cancer. This metabolite may serve as a potential biomarker for early detection of breast cancer and other types of cancer. It also has anti-inflammatory and glucose regulation effects in humans. The concentration of 3-(3,5-dihydroxyphenyl)-1-propanoic acid was found to be significantly higher in urine samples from women diagnosed with breast cancer than in urine samples from healthy controls, which suggests that this metabolite could be used as a marker for early detection of breast cancer.Formula:C9H10O4Purity:Min. 95%Color and Shape:PowderMolecular weight:182.17 g/mol


