CAS 26543-09-9
:L-Arabinaric acid, 2-deoxy-2-methyl-3,4-di-C-methyl-, 1,4-lactone
Description:
L-Arabinaric acid, 2-deoxy-2-methyl-3,4-di-C-methyl-, 1,4-lactone, identified by CAS number 26543-09-9, is a chemical compound that belongs to the class of lactones, which are cyclic esters formed from hydroxy acids. This compound features a unique structure characterized by the presence of multiple methyl groups and a lactone functional group, which contributes to its chemical reactivity and potential applications. It is derived from arabinose, a five-carbon sugar, and exhibits properties typical of sugar acids, including solubility in water and potential interactions with biological systems. The lactone form suggests that it may participate in various chemical reactions, including hydrolysis and esterification. Its specific stereochemistry and functional groups may influence its biological activity, making it of interest in fields such as biochemistry and pharmaceuticals. However, detailed studies on its biological properties and applications are necessary to fully understand its potential uses and effects.
Formula:C8H12O5
InChI:InChI=1S/C8H12O5/c1-4-5(9)13-8(3,6(10)11)7(4,2)12/h4,12H,1-3H3,(H,10,11)/t4-,7+,8-/m0/s1
InChI key:InChIKey=YTEPYGBARSCSMX-NETWJXFUSA-N
SMILES:C(O)(=O)[C@@]1(C)[C@](C)(O)[C@@H](C)C(=O)O1
Synonyms:- 2-Furoic acid, tetrahydro-3-hydroxy-2,3,4-trimethyl-5-oxo-, (2R,3R,4R)-
- (-)-Monocrotalic acid
- L-Arabinaric acid, 2-deoxy-2-methyl-3,4-di-C-methyl-, 1,4-lactone
- Monocrotalic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Monocrotalic acid
CAS:<p>Monocrotalic acid is a stable byproducer of dehydromonocrotaline reacting with cellular nucleophiles.</p>Formula:C8H12O5Color and Shape:SolidMolecular weight:188.18
