CAS 26544-38-7
:(Tetrapropenyl)succinic anhydride
Description:
(Tetrapropenyl)succinic anhydride, with the CAS number 26544-38-7, is a chemical compound characterized by its anhydride functional group derived from succinic acid, modified by the presence of tetrapropenyl groups. This structure imparts unique properties, including its reactivity and ability to participate in various chemical reactions, such as polymerization and cross-linking. The compound is typically a viscous liquid at room temperature and is known for its use as a reactive diluent and modifier in polymer formulations, particularly in the production of coatings, adhesives, and sealants. Its unsaturated nature allows it to undergo further reactions, making it valuable in the synthesis of more complex materials. Additionally, (tetrapropenyl)succinic anhydride exhibits good compatibility with a range of resins and can enhance the mechanical properties of the final products. Safety considerations should be taken into account when handling this compound, as it may cause irritation upon contact with skin or eyes and should be used in well-ventilated areas with appropriate personal protective equipment.
Formula:C16H26O3
InChI:InChI=1/C16H26O3/c1-10(2)6-11(3)7-12(4)8-13(5)14-9-15(17)19-16(14)18/h8,10-12,14H,6-7,9H2,1-5H3/b13-8+
Synonyms:- Dihydro-3-(tetrapropenyl)-2,5-furandione
- (Tetrapropenyl)succinic anhydride
- Succinic anhydride, (tetrapropenyl)-
- RD 174
- 2,5-Furandione, dihydro-3-(tetrapropenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tetrapropenylsuccinic Anhydride (mixture of branched chain isomers)
CAS:Formula:C16H26O3Purity:>85.0%(T)Color and Shape:Light yellow to Yellow to Orange clear liquid to cloudy liquidMolecular weight:266.382,5-Furandione, dihydro-3-(tetrapropenyl)-
CAS:Formula:C16H26O3Purity:85%Color and Shape:LiquidMolecular weight:266.3758


