CAS 26560-38-3: calcium dihydride - N-[(4-{[(2-amino-5-methyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)carbonyl]glutamic acid (1:1)
Description:Calcium dihydride - N-[(4-{[(2-amino-5-methyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)carbonyl]glutamic acid (1:1), with CAS number 26560-38-3, is a complex chemical compound that combines calcium dihydride, a hydride of calcium known for its use as a reducing agent and in hydrogen storage, with a specific amino acid derivative. The presence of the pteridinyl moiety suggests potential biological activity, as pteridines are often involved in various biochemical processes, including enzyme function and cofactor roles. The glutamic acid component indicates that this compound may have applications in biochemistry or pharmaceuticals, particularly in drug design or as a biochemical probe. The structure likely exhibits both ionic and covalent characteristics due to the presence of the calcium ion and the organic functional groups, which may influence its solubility, reactivity, and interaction with biological systems. Overall, this compound represents a unique intersection of inorganic and organic chemistry, with potential implications in medicinal chemistry and materials science.
Formula:C20H27CaN7O6
InChI:InChI=1/C20H25N7O6.Ca.2H/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29;;;/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31);;;/q;+2;2*-1
- Synonyms:
- 5-Methyltetrahydrofolate calcium (racemate)
- 5-Methyltetrahydrofolate calcium
- L-Glutamic acid, N-4-(2-amino-1,4,5,6,7,8-hexahydro-5-methyl-4-oxo-6-pteridinyl)methylaminobenzoyl-, calcium salt (1:1)
- Calcium 5-methyltetrahydrofolate