CAS 265644-03-9

2,5-Difluorobenzoic hydrazide

Description:

2,5-Difluorobenzoic hydrazide is an organic compound characterized by the presence of a hydrazide functional group attached to a difluorobenzoic acid moiety. This compound features two fluorine atoms substituted at the 2 and 5 positions of the benzene ring, which can significantly influence its chemical reactivity and physical properties. The presence of the hydrazide group (-CONH-NH2) suggests potential applications in the synthesis of various derivatives and in medicinal chemistry, particularly due to the ability of hydrazides to form hydrazones and their reactivity in condensation reactions. The fluorine substituents can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its biological activity. 2,5-Difluorobenzoic hydrazide is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure makes it a subject of interest for research in fields such as pharmaceuticals and agrochemicals, where fluorinated compounds often exhibit improved efficacy and stability.

Formula: C₇H₆F₂N₂O

InChI: InChI=1S/C7H6F2N2O/c8-4-1-2-6(9)5(3-4)7(12)11-10/h1-3H,10H2,(H,11,12)

InChI key: InChIKey=WNRRZAITMSBJFW-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=C(F)C=CC(F)=C1

Synonyms:

• Benzoic acid, 2,5-difluoro-, hydrazide
• 2,5-Difluorobenzoic hydrazide

2,5-Difluorobenzohydrazide

CAS: 265644-03-9

Formula: C₇H₆F₂N₂O

Molecular weight: 172.1321

Ref: IN-DA002TPR

2,5-Difluorobenzhydrazide

CAS: 265644-03-9

2,5-Difluorobenzhydrazide

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 172.13g/mol

Ref: 54-PC9952

2,5-Difluorobenzohydrazide

CAS: 265644-03-9

Formula: C₇H₆F₂N₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 172.135

Ref: 10-F218287

2,5-Difluorobenzhydrazide

CAS: 265644-03-9

2,5-Difluorobenzhydrazide is a synthetic drug that has potent antibacterial activity. It is also active against tumor cells and inhibits the production of enzymes that are involved in the synthesis of nucleic acids. The synthesis of 2,5-difluorobenzhydrazide starts with a diazonium salt, which reacts with an amine to form a nitrosobenzene. This nitrosobenzene undergoes a series of reactions to form 2,5-difluorobenzhydrazide.

Formula: C₇H₆F₂N₂O

Purity: Min. 95%

Molecular weight: 172.14 g/mol

Ref: 3D-QKA64403