CymitQuimica logo

CAS 265652-36-6

:

4-bromo-3-methylthiophene-2-carbonyl chloride

Description:
4-Bromo-3-methylthiophene-2-carbonyl chloride is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a bromine atom and a methylthio group, along with a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly due to the presence of the carbonyl chloride group, which can participate in nucleophilic substitution reactions. The bromine atom and the methylthio group can influence the compound's electronic properties and reactivity, making it useful in various synthetic applications, particularly in the field of organic synthesis and medicinal chemistry. Additionally, its properties may include moderate solubility in organic solvents and potential volatility. Safety precautions should be taken when handling this compound, as carbonyl chlorides can be hazardous, and appropriate protective measures should be employed to avoid exposure.
Formula:C6H4BrClOS
InChI:InChI=1/C6H4BrClOS/c1-3-4(7)2-10-5(3)6(8)9/h2H,1H3
SMILES:Cc1c(csc1C(=O)Cl)Br
Synonyms:
  • 2-Thiophenecarbonyl chloride, 4-bromo-3-methyl-
  • 4-Bromo-3-methylthiophene-2-carbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.