CymitQuimica logo

CAS 265652-39-9

:

4-Bromo-3-methyl-2-thiophenecarboxylic acid

Description:
4-Bromo-3-methyl-2-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of a bromine atom at the 4-position and a methyl group at the 3-position of the thiophene ring contributes to its unique chemical properties. This compound features a carboxylic acid functional group, which imparts acidic characteristics and enhances its reactivity in various chemical reactions, such as esterification and amidation. The bromine substituent can also participate in electrophilic aromatic substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its structural features. Its molecular structure and functional groups suggest that it may engage in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. Overall, 4-Bromo-3-methyl-2-thiophenecarboxylic acid is a valuable compound in synthetic organic chemistry.
Formula:C6H5BrO2S
InChI:InChI=1S/C6H5BrO2S/c1-3-4(7)2-10-5(3)6(8)9/h2H,1H3,(H,8,9)
InChI key:InChIKey=TUVDPNVBUMLEHW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C(Br)=CS1
Synonyms:
  • 2-Thiophenecarboxylic acid, 4-bromo-3-methyl-
  • 4-Bromo-3-methyl-2-thiophenecarboxylic acid
  • 4-Bromo-3-methylthiophene-2-carboxylic acid
Found 5 products.