CAS 26566-39-2
:hept-1-enofuranos-3-ulose
Description:
Hept-1-enofuranos-3-ulose, identified by its CAS number 26566-39-2, is a chemical compound that features a furanose structure, which is a five-membered ring containing oxygen. This compound is characterized by the presence of a double bond (alkene) at the first carbon position and a keto group at the third carbon, contributing to its reactivity and potential applications in organic synthesis. The furanosic structure suggests that it may participate in various chemical reactions, including cycloadditions and electrophilic additions, due to the electron-rich nature of the furan ring. Additionally, the presence of the double bond can lead to isomerization and polymerization under certain conditions. Hept-1-enofuranos-3-ulose may also exhibit biological activity, making it of interest in medicinal chemistry and natural product synthesis. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature, which are important considerations for its practical applications.
Formula:C7H10O7
InChI:InChI=1/C7H10O7/c8-1-2(9)3(10)6-4(11)5(12)7(13)14-6/h2-3,6,8-10,12-13H,1H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glucoascorbic acid, L-
CAS:Glucoascorbic acid, L- is a bioacive chemical.Formula:C7H10O7Color and Shape:SolidMolecular weight:206.15
