CAS 265664-52-6

[4-(2-methoxyethoxy)phenyl]boronic acid

Description:

[4-(2-Methoxyethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a methoxyethoxy group. This compound typically exhibits properties such as solubility in polar organic solvents due to the ether functionality, while the boronic acid group allows for reversible interactions with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The boron atom in the boronic acid group can form coordination complexes, which is significant in the context of drug design and materials science. Additionally, this compound may participate in Suzuki-Miyaura cross-coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Its structure suggests potential applications in the development of sensors, catalysts, and pharmaceuticals. Overall, [4-(2-methoxyethoxy)phenyl]boronic acid is a versatile compound with valuable chemical reactivity and functional properties.

Formula: C₉H₁₃BO₄

InChI: InChI=1/C9H13BO4/c1-13-6-7-14-9-4-2-8(3-5-9)10(11)12/h2-5,11-12H,6-7H2,1H3

SMILES: COCCOc1ccc(cc1)B(O)O

Synonyms:

• 4-(2-Methoxyethoxy)Phenyl)Boronic Acid

Boronic acid, B-[4-(2-methoxyethoxy)phenyl]-

CAS: 265664-52-6

Formula: C₉H₁₃BO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.0081

Ref: IN-DA002TQ8

4-(2-Methoxyethoxy)phenylboronic acid

CAS: 265664-52-6

4-(2-Methoxyethoxy)phenylboronic acid

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.01g/mol

Ref: 54-OR908296

(4-(2-Methoxyethoxy)phenyl)boronic acid

CAS: 265664-52-6

Formula: C₉H₁₃BO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.01

Ref: 10-F237666