CAS 26579-54-4

thieno[2,3-b]pyridin-3-amine

Description:

Thieno[2,3-b]pyridin-3-amine is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group (-NH2) at the 3-position of the pyridine ring, enhancing its reactivity and potential for forming hydrogen bonds. Thieno[2,3-b]pyridin-3-amine is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the presence of the amino group. The structure of this compound allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it can serve as a scaffold for designing bioactive molecules. Its heterocyclic nature also imparts interesting electronic properties, making it a candidate for use in organic electronics and materials science. Additionally, the compound may exhibit biological activity, which warrants further investigation into its pharmacological potential. Overall, thieno[2,3-b]pyridin-3-amine is a versatile compound with significant implications in various fields of research.

Formula: C₇H₆N₂S

InChI: InChI=1/C7H6N2S/c8-6-4-10-7-5(6)2-1-3-9-7/h1-4H,8H2

SMILES: c1cc2c(csc2nc1)N

Thieno[2,3-b]pyridin-3-amine

CAS: 26579-54-4

Formula: C₇H₆N₂S

Color and Shape: Solid

Molecular weight: 150.2009

Ref: IN-DA002TQT

Thieno[2,3-b]pyridin-3-amine

CAS: 26579-54-4

Purity: 98%

Molecular weight: 150.201

Ref: FT-T11486

3-Aminothieno[2,3-b]pyridine

CAS: 26579-54-4

3-Aminothieno[2,3-b]pyridine

Formula: C₇H₆N₂S

Purity: ≥95%

Color and Shape: green powder

Molecular weight: 150.20g/mol

Ref: 54-OR30577

Thieno[2,3-b]pyridin-3-amine

CAS: 26579-54-4

Thieno[2,3-b]pyridin-3-amine is an azide that can be synthesized by the reaction of sodium azide with potassium nitrite. Thieno[2,3-b]pyridin-3-amine is a strong oxidizing agent and can react with an organic molecule to form a nitrile. The nitrile group has two resonance structures. The intramolecular version of this reaction is called the 1,3-dipolar cycloaddition and involves the formation of a five membered ring from two three membered rings. Thieno[2,3-b]pyridin-3-amine reacts with esters and carboxylates in the presence of dieckmann's reagent to form azides. The dieckmann's reagent reacts with pyridine to form nicotinic acid and ammonia water.

Formula: C₇H₆N₂S

Purity: Min. 95%

Molecular weight: 150.2 g/mol

Ref: 3D-BBA57954