CAS 26581-81-7
:3-(1,3-Dihydro-1-oxo-2H-isoindol-2-yl)-2,6-piperidinedione
Description:
3-(1,3-Dihydro-1-oxo-2H-isoindol-2-yl)-2,6-piperidinedione, with the CAS number 26581-81-7, is a chemical compound that features a complex structure combining an isoindole moiety with a piperidine dione. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in medicinal chemistry due to its unique structural features. The presence of both the isoindole and piperidine rings suggests that it may interact with biological targets, potentially influencing various biochemical pathways. Its molecular structure may confer specific pharmacological properties, making it of interest in drug development. Additionally, the compound may exhibit solubility in organic solvents, while its stability can vary depending on environmental conditions such as pH and temperature. As with many organic compounds, it is essential to handle it with care, considering safety protocols to mitigate any potential hazards associated with its use. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C13H12N2O3
InChI:InChI=1S/C13H12N2O3/c16-11-6-5-10(12(17)14-11)15-7-8-3-1-2-4-9(8)13(15)18/h1-4,10H,5-7H2,(H,14,16,17)
InChI key:InChIKey=WENKGSGGXGQHSH-UHFFFAOYSA-N
SMILES:O=C1N(CC=2C1=CC=CC2)C3C(=O)NC(=O)CC3
Synonyms:- 2,6-piperidinedione, 3-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)-
- 2-(2,6-Dioxopiperidin-3-yl)phthalimidine
- 3-(1,3-Dihydro-1-oxo-2H-isoindol-2-yl)-2,6-dioxopiperidine
- 3-(1,3-Dihydro-1-oxo-2H-isoindol-2-yl)-2,6-piperidinedione
- 3-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione
- EM<sub>12</sub>
- Glutarimide, 2-(1-oxo-2-isoindolinyl)-
- α-EM 12
- EM12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-(1,3-Dihydro-1-oxo-2H-isoindol-2-yl)-2,6-piperidinedione
CAS:Formula:C13H12N2O3Purity:98%Color and Shape:SolidMolecular weight:244.2460Thalidomide Impurity 1
CAS:Formula:C13H12N2O3Color and Shape:White To Off-White SolidMolecular weight:244.253-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione
CAS:3-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione is a compound that inhibits the production of angiogenesis, which affects the growth and development of new blood vessels. This effect has been shown in laboratory tests on human lymphocytes and animal models for Alzheimer's disease. 3-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione is metabolized to its active form by the liver and it has been shown to be safe in rats with liver microsomes. 3-(1 -Oxo - 2,3 - dihydro - 1H - isoindol - 2 - yl)piperidine - 2,6 - dione has also been found to be selective for erythropoietin receptor over the other eryFormula:C13H12N2O3Purity:Min. 95%Molecular weight:244.25 g/molEM-12
CAS:EM-12, a Thalidomide analogue, is more active, stable, and boosts rat colon cancer studies.Formula:C13H12N2O3Purity:99.34%Color and Shape:SolidMolecular weight:244.25






