CAS 26585-13-7
:1-ethenyl-4-methoxy-9H-beta-carboline
Description:
1-Ethenyl-4-methoxy-9H-beta-carboline, with the CAS number 26585-13-7, is a chemical compound belonging to the beta-carboline family, which is characterized by a fused bicyclic structure containing a pyridine and an indole moiety. This compound features a methoxy group (-OCH3) at the 4-position and an ethenyl group (vinyl group) at the 1-position of the beta-carboline framework. It exhibits properties typical of beta-carbolines, including potential biological activity, such as neuroactivity and interactions with various receptors in the central nervous system. The presence of the methoxy group can influence its solubility and reactivity, while the ethenyl group may enhance its ability to participate in further chemical reactions, such as polymerization or cross-linking. Additionally, beta-carbolines are known for their role in various biochemical processes and have been studied for their potential therapeutic applications, including in the fields of neuropharmacology and cancer research. Overall, 1-ethenyl-4-methoxy-9H-beta-carboline is a compound of interest in both synthetic and medicinal chemistry.
Formula:C14H12N2O
InChI:InChI=1/C14H12N2O/c1-3-10-14-13(12(17-2)8-15-10)9-6-4-5-7-11(9)16-14/h3-8,16H,1H2,2H3
SMILES:C=Cc1c2c(c3ccccc3[nH]2)c(cn1)OC
Synonyms:- 1-Vinyl-4-methoxy-beta-carboline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-vinyl-4-dimethoxy-β-carboline
CAS:1-vinyl-4-dimethoxy-beta-carboline is a natural product from Picrasma javanica.Formula:C14H12N2OPurity:98%Color and Shape:SolidMolecular weight:224.26Dehydrocrenatine
CAS:Formula:C14H12N2OPurity:95%~99%Color and Shape:Yellow powderMolecular weight:224.263Dehydrocrenatine
CAS:Dehydrocreatine is a chemical derivative, which is synthesized from creatine, a well-known compound involved in energy metabolism. The source of this compound is a chemical modification of creatine, emphasizing its potential to be used where traditional creatine is applicable, but with distinct chemical properties that may yield different physiological effects.
Formula:C14H12N2OPurity:Min. 95%Molecular weight:224.26 g/molRef: 3D-BBA58513
Discontinued product


