CymitQuimica logo

CAS 26586-20-9

:

3-chloro-4-morpholino-benzoic acid

Description:
3-Chloro-4-morpholino-benzoic acid is an organic compound characterized by its benzoic acid structure, which includes a chlorine atom and a morpholino group. The presence of the chlorine atom at the 3-position of the aromatic ring contributes to its reactivity and potential applications in medicinal chemistry. The morpholino group, a six-membered ring containing nitrogen, enhances the compound's solubility and biological activity, making it of interest in pharmaceutical research. This compound typically appears as a white to off-white solid and is soluble in polar solvents. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its biological properties. 3-Chloro-4-morpholino-benzoic acid may be utilized in the synthesis of other chemical entities or as a building block in drug development, particularly in the design of compounds targeting specific biological pathways. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H12ClNO3
InChI:InChI=1/C11H12ClNO3/c12-9-7-8(11(14)15)1-2-10(9)13-3-5-16-6-4-13/h1-2,7H,3-6H2,(H,14,15)
InChI key:GZDHVZCNDDAJPE-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(=O)O)Cl)N1CCOCC1
Synonyms:
  • 3-Chloro-4-(morpholin-4-yl)benzoic acid
  • Benzoic acid, 3-chloro-4-(4-morpholinyl)-
Found 3 products.