CAS 26586-40-3

1-[4-(azepan-1-yl)phenyl]ethanone

Description:

1-[4-(Azepan-1-yl)phenyl]ethanone, with the CAS number 26586-40-3, is an organic compound characterized by its ketone functional group and a phenyl ring substituted with an azepane moiety. The structure features a phenyl group attached to a carbonyl group (C=O), which is further connected to an ethyl group. This compound exhibits properties typical of ketones, such as being polar and capable of participating in hydrogen bonding due to the presence of the carbonyl group. The azepane ring, a seven-membered saturated nitrogen-containing heterocycle, contributes to the compound's overall stability and may influence its biological activity. The presence of both the aromatic and aliphatic components suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's solubility and reactivity can be influenced by the steric and electronic effects of the azepane and phenyl groups, making it a subject of interest for further research in organic synthesis and drug design.

Formula: C₁₄H₁₉NO

InChI: InChI=1/C14H19NO/c1-12(16)13-6-8-14(9-7-13)15-10-4-2-3-5-11-15/h6-9H,2-5,10-11H2,1H3

SMILES: CC(=O)c1ccc(cc1)N1CCCCCC1

Synonyms:

• 1-(4-Azepan-1-Ylphenyl)Ethanone

1-(4-(Azepan-1-yl)phenyl)ethanone

CAS: 26586-40-3

Formula: C₁₄H₁₉NO

Molecular weight: 217.3068

Ref: IN-DA002TSG

(4-Azepan-1-ylphenyl)ethan-1-one

CAS: 26586-40-3

(4-Azepan-1-ylphenyl)ethan-1-one

Purity: ≥95%

Molecular weight: 217.31g/mol

Ref: 54-OR01991

1-(4-Azepan-1-ylphenyl)ethanone

CAS: 26586-40-3

Versatile small molecule scaffold

Formula: C₁₄H₁₉NO

Purity: Min. 95%

Molecular weight: 217.31 g/mol

Ref: 3D-BBA58640