CAS 26593-16-8
:3-(2-phenylhydrazinyl)cyclohex-2-en-1-one
Description:
3-(2-Phenylhydrazinyl)cyclohex-2-en-1-one, with the CAS number 26593-16-8, is an organic compound characterized by its unique structure that includes a cyclohexene ring and a phenylhydrazine moiety. This compound typically exhibits a yellow to orange coloration, indicative of its conjugated double bond system, which can contribute to its potential as a chromophore. It is likely to be soluble in organic solvents due to its hydrophobic cyclohexene structure, while its hydrazine group may impart some polar characteristics. The presence of the hydrazine functional group suggests potential reactivity, particularly in forming hydrazones or engaging in redox reactions. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry. The stability of 3-(2-phenylhydrazinyl)cyclohex-2-en-1-one can be influenced by environmental factors such as pH and temperature, and it may undergo various chemical transformations under different conditions. Overall, this compound represents a fascinating intersection of organic chemistry and potential applications in pharmaceuticals or materials science.
Formula:C12H14N2O
InChI:InChI=1/C12H14N2O/c15-12-8-4-7-11(9-12)14-13-10-5-2-1-3-6-10/h1-3,5-6,9,13-14H,4,7-8H2
SMILES:c1ccc(cc1)NNC1=CC(=O)CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-(2-Phenylhydrazino)-2-cyclohexen-1-one
CAS:Controlled ProductFormula:C12H14N2OColor and Shape:NeatMolecular weight:202.252

