CAS 265989-30-8

N-[4-(benzyloxy)phenyl]-4-methyl-3-oxopentanamide

Description:

N-[4-(benzyloxy)phenyl]-4-methyl-3-oxopentanamide, with the CAS number 265989-30-8, is an organic compound characterized by its amide functional group, which is linked to a ketone and a substituted phenyl group. This compound features a benzyloxy group, which enhances its lipophilicity and may influence its biological activity. The presence of the 4-methyl group contributes to its steric properties, potentially affecting its reactivity and interactions with biological targets. The overall structure suggests that it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure indicates potential for hydrogen bonding due to the amide group, which could play a role in its solubility and interaction with other molecules. As with many organic compounds, its stability, reactivity, and potential applications would depend on various factors, including environmental conditions and the presence of other chemical species. Further studies would be necessary to fully elucidate its characteristics and potential uses in various fields, including pharmaceuticals and materials science.

Formula: C₁₉H₂₁NO₃

InChI: InChI=1/C19H21NO3/c1-14(2)18(21)12-19(22)20-16-8-10-17(11-9-16)23-13-15-6-4-3-5-7-15/h3-11,14H,12-13H2,1-2H3,(H,20,22)

SMILES: CC(C)C(=O)CC(=O)Nc1ccc(cc1)OCc1ccccc1

Pentanamide, 4-methyl-3-oxo-N-[4-(phenylmethoxy)phenyl]-

CAS: 265989-30-8

Formula: C₁₉H₂₁NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 311.3749

Ref: IN-DA002TTQ

N-4-Benzyloxyphenyl Isobutyrylacetamide

Controlled Product

CAS: 265989-30-8

Applications N-4-Benzyloxyphenyl Isobutyrylacetamide (cas# 265989-30-8) is a compound useful in organic synthesis.

Formula: C₁₉H₂₁NO₃

Color and Shape: Neat

Molecular weight: 311.37

Ref: TR-B287680