CAS 265989-38-6
:1,3-Dioxane-4-acetic acid, 6-[2-[2-(4-fluorophenyl)-4-[[(4-hydroxyphenyl)amino]carbonyl]-5-(1-methylethyl)-3-(phenyl-d5)-1H-pyrrol-1-yl]ethyl]-2,2-dimethyl-, 1,1-dimethylethyl ester, (4R,6R)-
Description:
1,3-Dioxane-4-acetic acid, 6-[2-[2-(4-fluorophenyl)-4-[[(4-hydroxyphenyl)amino]carbonyl]-5-(1-methylethyl)-3-(phenyl-d5)-1H-pyrrol-1-yl]ethyl]-2,2-dimethyl-, 1,1-dimethylethyl ester, (4R,6R)-, is a complex organic compound characterized by its multi-functional structure, which includes a dioxane ring, an acetic acid moiety, and various aromatic and aliphatic substituents. This compound features a fluorophenyl group, which may impart specific electronic properties, and a pyrrole ring that contributes to its potential biological activity. The presence of hydroxyl and amino groups suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The stereochemistry indicated by the (4R,6R) designation suggests specific spatial arrangements that could influence the compound's reactivity and interactions. Its ester functionality may also affect solubility and stability. Overall, this compound's intricate structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C40H42D5FN2O6
InChI:InChI=1S/C40H47FN2O6/c1-25(2)36-35(38(46)42-29-17-19-30(44)20-18-29)34(26-11-9-8-10-12-26)37(27-13-15-28(41)16-14-27)43(36)22-21-31-23-32(48-40(6,7)47-31)24-33(45)49-39(3,4)5/h8-20,25,31-32,44H,21-24H2,1-7H3,(H,42,46)/t31-,32-/m1/s1/i8D,9D,10D,11D,12D
InChI key:InChIKey=AQMFQOCFGPMVGX-DHJJOHBTSA-N
SMILES:C(NC1=CC=C(O)C=C1)(=O)C=2C(=C(N(CC[C@@H]3C[C@H](CC(OC(C)(C)C)=O)OC(C)(C)O3)C2C(C)C)C4=CC=C(F)C=C4)C5=C(C(=C(C(=C5[2H])[2H])[2H])[2H])[2H]
Synonyms:- 1,3-Dioxane-4-acetic acid, 6-[2-[2-(4-fluorophenyl)-4-[[(4-hydroxyphenyl)amino]carbonyl]-5-(1-methylethyl)-3-(phenyl-d5)-1H-pyrrol-1-yl]ethyl]-2,2-dimethyl-, 1,1-dimethylethyl ester, (4R,6R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Hydroxy Atorvastatin-d5 Acetonide tert-Butyl Ester
CAS:Controlled ProductFormula:C40H42D5FN2O6Color and Shape:NeatMolecular weight:675.84
