
CAS 26599-17-7
:4'-Thio-beta-D-arabinofuranosylcytosine
Description:
4'-Thio-beta-D-arabinofuranosylcytosine, commonly referred to as T-araC, is a nucleoside analog that exhibits significant antiviral and anticancer properties. It is characterized by the presence of a sulfur atom at the 4' position of the arabinofuranosyl sugar moiety, which differentiates it from its parent compound, cytarabine. This modification enhances its stability and bioactivity. T-araC is primarily used in research settings and has shown potential in treating various viral infections and certain types of cancer, particularly hematological malignancies. The compound is typically administered intravenously and is known to interfere with DNA synthesis by incorporating into the growing DNA strand, leading to chain termination. Its mechanism of action involves inhibition of DNA polymerase, which is crucial for DNA replication. Additionally, T-araC's pharmacokinetics and toxicity profile are subjects of ongoing research, as understanding these aspects is vital for optimizing its therapeutic applications. Overall, 4'-Thio-beta-D-arabinofuranosylcytosine represents a significant advancement in the development of nucleoside-based therapeutics.
Formula:C9H13N3O4S
InChI:InChI=1/C9H13N3O4S/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1
Synonyms:- 4-amino-1-(4-thio-beta-D-arabinofuranosyl)pyrimidin-2(1H)-one
- GS-7836
- 4-Amino-1-(4-thio-beta-D-arabinofuranosyl)-2(1H)-pyrimidinone
- 1-(4-Thio-beta-D-arabinofuranosyl)cytosine
- OSI-7836
- 4'-Thio-ara-C
- Thiarabine
- 4-Amino-1-(4-thio-β-D-arabinofuranosyl)-2(1H)-pyrimidinone
- 2(1H)-Pyrimidinone, 4-amino-1-(4-thio-β-D-arabinofuranosyl)-
- 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]pyrimidin-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Amino-1-((2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrothiophen-2-yl)pyrimidin-2(1H)-one
CAS:4-Amino-1-((2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrothiophen-2-yl)pyrimidin-2(1H)-onePurity:98%Molecular weight:259.29g/molThiarabine
CAS:Thiarabine displays effective anti-tumor activity. It also inhibition of DNA synthesis.Formula:C9H13N3O4SPurity:98%Color and Shape:SolidMolecular weight:259.28Thiarabine
CAS:Thiarabine is a nucleoside that is classified as a purine analogue. It is used in the treatment of leukemia, lymphomas, and skin cancer. Thiarabine has been shown to be effective against human tumours and carcinoma cell lines with significant cytotoxicity. It has been shown to have synergistic effects when combined with other drugs such as polymyxin B or doxorubicin. Thiarabine also inhibits the tumorigenesis of MDA-MB-231 breast cancer cells by inducing apoptosis in leukemic cells.
Formula:C9H13N3O4SPurity:Min. 95%Molecular weight:259.28 g/molRef: 3D-BBA59917
Discontinued product


