CAS 26608-58-2

1-azabicyclo[2.2.2]oct-4-ylmethanol

Description:

1-Azabicyclo[2.2.2]oct-4-ylmethanol, with the CAS number 26608-58-2, is a bicyclic organic compound characterized by its unique bicyclic structure that includes a nitrogen atom within the ring system. This compound features a hydroxymethyl group (-CH2OH) attached to the bicyclic framework, which contributes to its reactivity and potential applications in organic synthesis. The presence of the nitrogen atom imparts basic properties to the molecule, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The bicyclic structure also influences its steric and electronic properties, making it a subject of interest in medicinal chemistry and drug design. Additionally, the compound may exhibit specific solubility characteristics and stability under various conditions, which are essential for its practical applications. Overall, 1-azabicyclo[2.2.2]oct-4-ylmethanol is notable for its structural complexity and potential utility in chemical research and development.

Formula: C₈H₁₅NO

InChI: InChI=1/C8H15NO/c10-7-8-1-4-9(5-2-8)6-3-8/h10H,1-7H2

SMILES: C1CN2CCC1(CC2)CO

Synonyms:

• 1-Azabicyclo(2.2.2)octane-4-methanol
• 4-(Hydroxymethyl)-1-azabicyclo[2.2.2]octane

1-Azabicyclo[2.2.2]octane-4-methanol

CAS: 26608-58-2

Formula: C₈H₁₅NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 141.2108

Ref: IN-DA002TV5

{1-azabicyclo[2.2.2]octan-4-yl}methanol

CAS: 26608-58-2

{1-azabicyclo[2.2.2]octan-4-yl}methanol

Purity: 98%

Ref: 54-OR1037498

{1-AZABICYCLO[2.2.2]OCTAN-4-YLMETHANOL

CAS: 26608-58-2

Purity: 98%

Molecular weight: 141.2140045

Ref: 10-F806522

1-Azabicyclo[2.2.2]octan-4-ylmethanol

Controlled Product

CAS: 26608-58-2

Formula: C₈H₁₅NO

Color and Shape: Neat

Molecular weight: 141.211

Ref: TR-B408308

1-azabicyclo[2.2.2]octan-4-ylmethanol

CAS: 26608-58-2

Sinensetin is an anti-inflammatory compound that belongs to the chromones class of compounds. Sinensetin has been shown to have anti-inflammatory properties at high temperatures in experimental models. The mechanism of action for sinensetin is not well understood, but it may be due to the inhibition of prostaglandin synthesis or by direct interaction with TNF-α. Sinensetin also has antioxidant and antifungal properties, which are attributed to its ability to scavenge free radicals and inhibit lipid peroxidation. Sinensetin was found in a variety of plants from China, including Acanthopanax senticosus and Eurycoma longifolia.

Formula: C₈H₁₅NO

Purity: Min. 95%

Molecular weight: 141.21 g/mol

Ref: 3D-BBA60858