CymitQuimica logo

CAS 266359-48-2

:

(3S)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-(methylsulfanyl)pentanoic acid

Description:
The chemical substance known as (3S)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-(methylsulfanyl)pentanoic acid, with CAS number 266359-48-2, is a synthetic amino acid derivative. It features a pentanoic acid backbone with a chiral center at the third carbon, indicating its stereochemistry as (3S). The molecule is characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly used in peptide synthesis to protect amino groups. Additionally, it contains a methylsulfanyl group at the fifth position, which can influence its reactivity and solubility. This compound is typically utilized in the field of organic chemistry and biochemistry, particularly in the synthesis of peptides and other complex molecules. Its structural complexity and functional groups suggest potential applications in drug development and research involving amino acid derivatives. The presence of both hydrophobic (fluorene) and polar (carboxylic acid) components contributes to its unique properties, affecting its interactions in biological systems.
Formula:C21H23NO4S
InChI:InChI=1/C21H23NO4S/c1-27-11-10-14(12-20(23)24)22-21(25)26-13-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,14,19H,10-13H2,1H3,(H,22,25)(H,23,24)/t14-/m1/s1
InChI key:XYWOGXWKXWWADY-AWEZNQCLSA-N
SMILES:CSCC[C@H](CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:
  • Fmoc-β-HoMet-OH
  • Fmoc-L-Beta-Homomethionine
Found 5 products.