CymitQuimica logo

CAS 266360-56-9

:

(2R)-2-acetamido-3-(2,6-difluorophenyl)propanoic acid

Description:
(2R)-2-acetamido-3-(2,6-difluorophenyl)propanoic acid, with CAS number 266360-56-9, is an amino acid derivative characterized by the presence of an acetamido group and a difluorophenyl moiety. This compound features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the R configuration. The difluorophenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The carboxylic acid functional group provides acidic properties, while the acetamido group contributes to its solubility and potential interactions in biological systems. This compound may exhibit specific interactions with biological targets, making it relevant in drug design and development. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting various diseases. Overall, the unique combination of functional groups and stereochemistry in (2R)-2-acetamido-3-(2,6-difluorophenyl)propanoic acid positions it as a compound of interest in both synthetic and biological chemistry.
Formula:C11H11F2NO3
InChI:InChI=1/C11H11F2NO3/c1-6(15)14-10(11(16)17)5-7-8(12)3-2-4-9(7)13/h2-4,10H,5H2,1H3,(H,14,15)(H,16,17)/t10-/m1/s1
InChI key:SOVRNHLRLBIHRI-SNVBAGLBSA-N
SMILES:CC(=N[C@H](Cc1c(cccc1F)F)C(=O)O)O
Synonyms:
  • D-Phenylalanine, N-acetyl-2,6-difluoro-
  • N-Acetyl-2,6-difluoro-D-phenylalanine
  • (R)-2-Acetylamino-3-(2,6-difluoro-phenyl)-propionic acid
Found 1 products.