CAS 26638-45-9

2-[methyl(phenyl)sulfamoyl]benzoate

Description:

2-[Methyl(phenyl)sulfamoyl]benzoate, with the CAS number 26638-45-9, is a chemical compound characterized by its sulfonamide functional group, which is linked to a benzoate moiety. This compound features a methyl group and a phenyl group attached to the sulfur atom, contributing to its unique properties. It typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the presence of the phenyl group. The sulfonamide group imparts potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are common in organic synthesis. Additionally, its stability under standard conditions and potential reactivity with electrophiles or nucleophiles can be explored in various applications, including drug design and development. Overall, 2-[methyl(phenyl)sulfamoyl]benzoate is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₂NO₄S

InChI: InChI=1/C14H13NO4S/c1-15(11-7-3-2-4-8-11)20(18,19)13-10-6-5-9-12(13)14(16)17/h2-10H,1H3,(H,16,17)/p-1

SMILES: CN(c1ccccc1)S(=O)(=O)c1ccccc1C(=O)[O-]

2-[Methyl(phenyl)sulfamoyl]benzoic acid

CAS: 26638-45-9

Versatile small molecule scaffold

Formula: C₁₄H₁₃NO₄S

Purity: Min. 95%

Molecular weight: 291.32 g/mol

Ref: 3D-BBA63845