CymitQuimica logo

CAS 26643-62-9

:

bis[8-(diaminomethyleneazaniumyl)octyl]ammonium sulfate

Description:
Bis[8-(diaminomethyleneazaniumyl)octyl]ammonium sulfate, with the CAS number 26643-62-9, is a quaternary ammonium compound characterized by its complex structure that includes a sulfate group and multiple amine functionalities. This compound typically exhibits surfactant properties, making it useful in various applications, including as a biocide, antimicrobial agent, or in formulations requiring enhanced surface activity. Its molecular structure suggests it has a hydrophilic head due to the ammonium and sulfate groups, while the long octyl chains provide hydrophobic characteristics, allowing it to interact with both polar and non-polar environments. The presence of multiple amine groups indicates potential for hydrogen bonding and reactivity, which can enhance its efficacy in biological systems. Additionally, this compound may exhibit low toxicity and biodegradability, making it suitable for applications in pharmaceuticals, personal care products, and environmental remediation. However, specific safety and handling guidelines should be followed due to its chemical nature.
Formula:C18H44N7O4S
InChI:InChI=1/C18H41N7.H2O4S/c19-17(20)24-15-11-7-3-1-5-9-13-23-14-10-6-2-4-8-12-16-25-18(21)22;1-5(2,3)4/h23H,1-16H2,(H4,19,20,24)(H4,21,22,25);(H2,1,2,3,4)/p+1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.