CAS 2665-13-6

2,2′-(1-Methyltrimethylenedioxy)bis[4-methyl-1,3,2-dioxaborinane]

Description:

2,2′-(1-Methyltrimethylenedioxy)bis[4-methyl-1,3,2-dioxaborinane], with the CAS number 2665-13-6, is a chemical compound characterized by its unique structure that includes two dioxaborinane units linked by a trimethylenedioxy bridge. This compound features boron atoms within its dioxaborinane rings, which contribute to its potential applications in organic synthesis and materials science. The presence of methyl groups enhances its stability and solubility in organic solvents. The dioxaborinane moiety is known for its ability to participate in various chemical reactions, including those involving nucleophilic substitution and coordination chemistry. Additionally, the compound may exhibit interesting optical properties due to its molecular structure, making it a candidate for research in photonic applications. Its synthesis typically involves the reaction of boron-containing precursors with suitable organic reagents, and it may be of interest in the development of boron-based drugs or catalysts. Overall, this compound represents a fascinating area of study within the field of organoboron chemistry.

Formula: C₁₂H₂₄B₂O₆

InChI: InChI=1S/C12H24B2O6/c1-10-4-7-15-13(18-10)16-8-5-11(2)19-14-17-9-6-12(3)20-14/h10-12H,4-9H2,1-3H3

InChI key: InChIKey=RCIYLEACODIIKU-UHFFFAOYSA-N

SMILES: O(C(CCOB1OC(C)CCO1)C)B2OC(C)CCO2

Synonyms:

• 1,3-Butanediol, cyclic diester with 1-methyltrimethylene borate
• 1,3-Butanediol, cyclic ester with boric acid (H3BO3), 1-methyltrimethylene ester
• 2,2′-(1-Methyltrimethylenedioxy)bis[4-methyl-1,3,2-dioxaborinane]
• 1,3,2-Dioxaborinane, 2,2′-[(1-methyl-1,3-propanediyl)bis(oxy)]bis[4-methyl-
• 2,2′-[(1-Methyl-1,3-propanediyl)bis(oxy)]bis[4-methyl-1,3,2-dioxaborinane]

2,2′-(1-Methyltrimethylenedioxy)bis[4-methyl-1,3,2-dioxaborinane]

CAS: 2665-13-6

Formula: C₁₂H₂₄B₂O₆

Color and Shape: Neat

Ref: TR-M916420