CAS 2665-57-8

Conodurine

Description:

Conodurine, with the CAS number 2665-57-8, is an alkaloid derived from the plant species of the Conium genus, particularly associated with the poison hemlock. This compound is characterized by its complex bicyclic structure, which contributes to its biological activity. Conodurine exhibits neurotoxic properties, primarily affecting the central nervous system, and has been studied for its potential pharmacological effects. It is known to interact with neurotransmitter systems, particularly influencing cholinergic pathways. The substance is typically found in trace amounts in plant extracts and has garnered interest in the field of medicinal chemistry for its potential therapeutic applications, although its toxicity limits practical use. As with many alkaloids, conodurine's solubility and stability can vary depending on environmental conditions, such as pH and temperature. Safety precautions are essential when handling this compound due to its toxic nature, and further research is necessary to fully understand its mechanisms of action and potential applications in medicine.

Formula: C₄₃H₅₂N₄O₅

InChI: InChI=1S/C43H52N4O5/c1-7-24-17-23-20-43(42(49)52-6)39-28(15-16-47(21-23)40(24)43)27-13-14-34(50-4)36(38(27)45-39)31-18-29-25(8-2)22-46(3)33(35(29)41(48)51-5)19-30-26-11-9-10-12-32(26)44-37(30)31/h8-14,23-24,29,31,33,35,40,44-45H,7,15-22H2,1-6H3

InChI key: InChIKey=QJHYXWBJZHUJGS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C12C3=C(C=4C(N3)=C(C(OC)=CC4)C5C6=C(C=7C(N6)=CC=CC7)CC8C(C(OC)=O)C(C5)C(=CC)CN8C)CCN9C1C(CC)CC(C2)C9

Synonyms:

• Vobasan, ibogamine-18-carboxylic acid deriv.
• 2,6-Methano-1H-azecino[5,4-b]indole, ibogamine-18-carboxylic acid deriv.
• 6,9-Methano-5H-pyrido[1′,2′:1,2]azepino[4,5-b]indole, ibogamine-18-carboxylic acid deriv.
• Conodurine
• Ibogamine-18-carboxylic acid, 13-methoxy-14-[(3α)-17-methoxy-17-oxovobasan-3-yl]-, methyl ester

Conodurine

CAS: 2665-57-8

Conodurine shows leishmanicidal and antibacterial activities, it shows inhibition activity for acetyl (AChE) and butyrylcholinesterase (BuChE).

Formula: C₄₃H₅₂N₄O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 704.912

Ref: TM-TN3696

Conodurine

CAS: 2665-57-8

Conodurine is an alkaloid compound, which is a naturally occurring chemical often characterized by nitrogen atoms in its structure. It is sourced primarily from specific plant species where it serves various ecological roles, such as deterring herbivores or providing defense against microbial infections. The mode of action of Conodurine involves interaction with specific cellular receptors or enzymes, which can modulate physiological pathways in the organism. Through these interactions, it may influence biological processes such as neurotransmission or cellular signaling.

Formula: C₄₃H₅₂N₄O₅

Purity: Min. 95%

Molecular weight: 704.90 g/mol

Ref: 3D-CAA66557