CAS 26660-66-2

3-[3-(piperidin-1-yl)propoxy]-1-[3-(trifluoromethyl)phenyl]-1H-indazole

Description:

3-[3-(Piperidin-1-yl)propoxy]-1-[3-(trifluoromethyl)phenyl]-1H-indazole, with the CAS number 26660-66-2, is a synthetic organic compound characterized by its complex structure, which includes an indazole core, a piperidine moiety, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of the trifluoromethyl group, which can enhance its biological activity and membrane permeability. The piperidine ring contributes to its potential as a pharmacophore, often associated with various biological activities, including interactions with neurotransmitter receptors. The indazole structure is known for its versatility in medicinal chemistry, often serving as a scaffold for drug development. Additionally, the presence of fluorine atoms can influence the compound's stability and reactivity. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of therapeutics targeting central nervous system disorders or other conditions where modulation of specific receptors is desired.

Formula: C₂₂H₂₄F₃N₃O

InChI: InChI=1/C22H24F3N3O/c23-22(24,25)17-8-6-9-18(16-17)28-20-11-3-2-10-19(20)21(26-28)29-15-7-14-27-12-4-1-5-13-27/h2-3,6,8-11,16H,1,4-5,7,12-15H2

SMILES: C1CCN(CC1)CCCOc1c2ccccc2n(c2cccc(c2)C(F)(F)F)n1

3-(3-Piperidinopropoxy)-1-[3-(Trifluoromethyl)Phenyl]-1H-Indazole

Controlled Product

CAS: 26660-66-2

3-(3-Piperidinopropoxy)-1-[3-(Trifluoromethyl)Phenyl]-1H-Indazole is a compound that functions as an actuator. It can be used to implement force, such as controlling a change in the position of a control or actuation, and it can also be used to shift control. 3-(3-Piperidinopropoxy)-1-[3-(Trifluoromethyl)Phenyl]-1H-Indazole is an actuation method that can be controlled by implementing force.

Formula: C₂₂H₂₄F₃N₃O

Purity: Min. 95%

Molecular weight: 403.44 g/mol

Ref: 3D-FP97740