CAS 26663-42-3

1H-indazol-3-ylacetic acid

Description:

1H-Indazol-3-ylacetic acid, with the CAS number 26663-42-3, is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features an acetic acid functional group attached to the indazole at the 3-position, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, reflecting its ability to form hydrogen bonds due to the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for potential interactions with various biological targets, and it may participate in various chemical reactions typical of carboxylic acids and heterocyclic compounds. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c12-9(13)5-8-6-3-1-2-4-7(6)10-11-8/h1-4H,5H2,(H,10,11)(H,12,13)

SMILES: c1ccc2c(c1)c(CC(=O)O)n[nH]2

Synonyms:

• 1H-indazole-3-acetic acid

2-(1H-Indazol-3-yl)acetic acid

CAS: 26663-42-3

Formula: C₉H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA0037PJ

2-(1H-Indazol-3-yl)acetic acid

CAS: 26663-42-3

2-(1H-Indazol-3-yl)acetic acid

Purity: 97%

Molecular weight: 176.17g/mol

Ref: 54-OR76197

2-(1H-Indazol-3-yl)acetic acid

CAS: 26663-42-3

Formula: C₉H₈N₂O₂

Purity: 97%

Color and Shape: Solid, Yellow powder

Molecular weight: 176.175

Ref: 10-F224628

(1H-INDAZOL-3-YL)-ACETIC ACID

CAS: 26663-42-3

Purity: 97%

Molecular weight: 176.1750031

Ref: 10-F793893