CAS 26670-89-3
:2-bromo-4-iodo-1-methylbenzene
Description:
2-Bromo-4-iodo-1-methylbenzene, also known as 1-methyl-2-bromo-4-iodobenzene, is an organic compound characterized by the presence of a methyl group, a bromine atom, and an iodine atom attached to a benzene ring. This compound features a substituted aromatic structure, which contributes to its chemical reactivity and physical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of halogen substituents (bromine and iodine) enhances its reactivity, making it useful in various organic synthesis applications, including cross-coupling reactions and as an intermediate in the production of pharmaceuticals and agrochemicals. The compound is generally insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. Safety precautions should be taken when handling this substance, as both bromine and iodine are hazardous. Proper storage and disposal methods are essential to minimize environmental impact and health risks.
Formula:C7H6BrI
InChI:InChI=1/C7H6BrI/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3
SMILES:Cc1ccc(cc1Br)I
Synonyms:- Benzene, 2-bromo-4-iodo-1-methyl-
- 2-Bromo-4-iodotoluene
- 1-Bromo-5-Iodo-2-Methylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-4-iodo-1-methylbenzene
CAS:Formula:C7H6BrIPurity:98%Color and Shape:LiquidMolecular weight:296.93102-Bromo-4-iodotoluene
CAS:2-Bromo-4-iodotolueneFormula:C7H6BrIPurity:98%Color and Shape: brown liquidMolecular weight:296.93g/mol2-Bromo-4-iodotoluene
CAS:2-Bromo-4-iodotoluene is a chemical that belongs to the group of useful building blocks. 2-Bromo-4-iodotoluene is a reagent and speciality chemical that can be used as a reactant or intermediate in organic synthesis. It is also a versatile building block for the preparation of complex compounds. 2-Bromo-4-iodotoluene can be used as an intermediate for the synthesis of specialized chemicals, such as pharmaceuticals, dyes, explosives and fragrances. 2-Bromo-4-iodotoluene has been shown to be an effective reagent in organic synthesis and has been used in the preparation of many complex compounds.Formula:C7H6BrIPurity:Min. 95%Color and Shape:PowderMolecular weight:296.93 g/mol



