CAS 26684-56-0
:4-(tetrahydro-2H-pyran-4-yl)pyridine
Description:
4-(Tetrahydro-2H-pyran-4-yl)pyridine, with the CAS number 26684-56-0, is an organic compound characterized by its pyridine and tetrahydropyran moieties. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and a tetrahydro-2H-pyran group, which is a saturated cyclic ether. The presence of the tetrahydropyran ring contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility can vary, often being soluble in organic solvents while exhibiting limited solubility in water. The compound may exhibit interesting biological activities due to the presence of both nitrogen and oxygen heteroatoms, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-2,5-6,10H,3-4,7-8H2
SMILES:c1cnccc1C1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(Tetrahydropyran-4-yl)-pyridine
CAS:Formula:C10H13NOColor and Shape:Solid, Low Melting SolidMolecular weight:163.22
