CymitQuimica logo

CAS 26684-57-1

:

3-(4-Pyridinyl)-1,5-pentanediol

Description:
3-(4-Pyridinyl)-1,5-pentanediol, with the CAS number 26684-57-1, is an organic compound characterized by its structure, which includes a pyridine ring and a pentanediol chain. This compound features a hydroxyl group (-OH) at both the first and fifth positions of the pentane chain, contributing to its potential as a diol. The presence of the pyridine moiety imparts unique properties, such as the ability to participate in hydrogen bonding and its potential use in coordination chemistry. The compound is likely to exhibit moderate solubility in polar solvents due to the hydroxyl groups, while the pyridine ring may enhance its reactivity and interaction with various biological systems. Additionally, 3-(4-Pyridinyl)-1,5-pentanediol may have applications in pharmaceuticals or as a building block in organic synthesis, owing to its functional groups that can undergo further chemical transformations. Its specific physical and chemical properties, such as melting point, boiling point, and reactivity, would require empirical measurement or detailed literature reference for precise characterization.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c12-7-3-10(4-8-13)9-1-5-11-6-2-9/h1-2,5-6,10,12-13H,3-4,7-8H2
InChI key:InChIKey=IVTBMCOJNSRTAY-UHFFFAOYSA-N
SMILES:C(CCO)(CCO)C=1C=CN=CC1
Synonyms:
  • 1,5-Pentanediol, 3-(4-pyridinyl)-
  • 1,5-Pentanediol, 3-(4-pyridyl)-
  • 3-(4-Pyridinyl)-1,5-pentanediol
  • 3-(Pyridin-4-Yl)Pentane-1,5-Diol
  • 3-(4-Pyridyl)pentane-1,5-diol
Found 1 products.