
CAS 2669-09-2
:Ethanethioamide, S-oxide
Description:
Ethanethioamide, S-oxide, also known as thioacetamide S-oxide, is an organic compound characterized by the presence of a thioamide functional group with an additional sulfur oxide moiety. Its molecular structure features a carbon atom bonded to a sulfur atom, which is further bonded to an oxygen atom, indicating the presence of a sulfoxide. This compound typically appears as a colorless to pale yellow solid or liquid and is soluble in polar solvents. It is known for its potential applications in organic synthesis and as a reagent in various chemical reactions. The compound exhibits properties typical of thioamides, including the ability to participate in nucleophilic reactions due to the presence of the sulfur atom. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. However, handling precautions are necessary due to its potential toxicity and reactivity. As with all chemical substances, proper safety measures should be observed when working with ethanethioamide, S-oxide.
Formula:C2H5NOS
InChI:InChI=1S/C2H5NOS/c1-2(3)5-4/h3H2,1H3
InChI key:InChIKey=DRLWOIKWASTVIQ-UHFFFAOYSA-N
SMILES:C(=S=O)(C)N
Synonyms:- Thioacetamide S-oxide
- Acetamide, thio-, S-oxide
- NSC 371202
- Ethanethioamide, S-oxide
- Thioacetamide sulfoxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thioacetamide-S-oxide
CAS:<p>Thioacetamide-S-oxide, a metabolite of Thiocetamide, functions as a δ-aminolevulinic acid (ALA) synthetase inhibitor [1].</p>Formula:C2H5NOSColor and Shape:SolidMolecular weight:91.13
