CymitQuimica logo

CAS 26693-24-3

:

Kahweofuran

Description:
Kahweofuran is a naturally occurring compound primarily found in coffee beans, particularly in Arabica coffee. It belongs to the class of compounds known as furan derivatives and is characterized by its unique aromatic properties. Kahweofuran is recognized for its potential antioxidant and anti-inflammatory effects, contributing to the health benefits often associated with coffee consumption. The compound has a molecular formula that reflects its furan structure, which includes a five-membered ring containing oxygen. Its presence in coffee is thought to influence flavor and aroma, adding to the complexity of coffee's sensory profile. Additionally, kahweofuran has been studied for its potential role in modulating certain biological pathways, although further research is needed to fully understand its mechanisms and effects. As a chemical substance, it is typically analyzed using techniques such as chromatography and mass spectrometry to determine its concentration and purity in various samples.
Formula:C7H8OS
InChI:InChI=1S/C7H8OS/c1-5-7-6(4-8-5)2-3-9-7/h4H,2-3H2,1H3
InChI key:InChIKey=WQOKVCDOEDFSAJ-UHFFFAOYSA-N
SMILES:CC1=C2C(CCS2)=CO1
Synonyms:
  • 2,3-Dihydro-6-methylthieno[2,3-c]furan
  • Kahweofuran
  • Thieno[2,3-C]Furan, 2,3-Dihydro-6-Methyl-
  • 6-Methyl-2,3-dihydrothieno[2,3-c]furan
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.