CAS 267006-24-6

potassium trifluoro(3-fluorophenyl)borate(1-)

Description:

Potassium trifluoro(3-fluorophenyl)borate(1-) is an organoboron compound characterized by the presence of a boron atom bonded to a trifluoromethyl group and a 3-fluorophenyl group. This compound typically exhibits properties associated with both boron and fluorinated organic compounds, such as high thermal stability and unique reactivity patterns. The trifluoromethyl group contributes to its lipophilicity and can enhance the compound's ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the potassium ion indicates that this compound is a salt, which may influence its solubility in polar solvents. Additionally, the fluorine atoms in the structure can impart distinctive electronic properties, making it useful in applications such as catalysis, materials science, and organic synthesis. Overall, potassium trifluoro(3-fluorophenyl)borate(1-) is a versatile compound with potential utility in various chemical processes due to its unique structural features and reactivity.

Formula: C₆H₄BF₄K

InChI: InChI=1/C6H4BF4.K/c8-6-3-1-2-5(4-6)7(9,10)11;/h1-4H;/q-1;+1

SMILES: c1cc(cc(c1)F)[B-](F)(F)F.K

Potassium 3-fluorophenyltrifluoroborate

CAS: 267006-24-6

Formula: C₆H₄BF₄K

Purity: 98%

Color and Shape: Solid

Molecular weight: 201.9989

Ref: IN-DA00BEBY

Potassium (3-fluorophenyl)trifluoroborate

CAS: 267006-24-6

Potassium (3-fluorophenyl)trifluoroborate

Purity: 98%

Molecular weight: 202.00g/mol

Ref: 54-PC5661

Potassium trifluoro(3-fluorophenyl)borate

CAS: 267006-24-6

Formula: C₆H₄BF₄K

Purity: 98%

Color and Shape: No data available.

Molecular weight: 202

Ref: 10-F050579