
CAS 2671-68-3
:Lanosterol acetate
Description:
Lanosterol acetate is a chemical compound classified as a steroid and is derived from lanosterol, which is a precursor in the biosynthesis of sterols. It is characterized by its molecular structure, which includes a tetracyclic framework typical of steroids, along with an acetate functional group. This compound is typically a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and chloroform, but has limited solubility in water. Lanosterol acetate plays a significant role in various biological processes, including cholesterol biosynthesis and the formation of other steroid compounds. It is often studied for its potential applications in pharmaceuticals and biochemistry, particularly in the context of its role in cellular membranes and as a precursor for the synthesis of more complex steroid molecules. Additionally, lanosterol acetate has been investigated for its potential therapeutic properties, including its effects on cellular signaling pathways and its role in skin health.
Formula:C32H52O2
InChI:InChI=1S/C32H52O2/c1-21(2)11-10-12-22(3)24-15-19-32(9)26-13-14-27-29(5,6)28(34-23(4)33)17-18-30(27,7)25(26)16-20-31(24,32)8/h11,22,24,27-28H,10,12-20H2,1-9H3/t22-,24-,27+,28+,30-,31-,32+/m1/s1
InChI key:InChIKey=BQPPJGMMIYJVBR-VBGFMNGASA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](OC(C)=O)CC4)[H])CC[C@]1(C)[C@@]([C@@H](CCC=C(C)C)C)(CC2)[H]
Synonyms:- Lanosteryl acetate
- Lanosta-8,24-dien-3-ol, acetate, (3β)-
- Lanosta-8,24-dien-3β-ol, acetate
- Lanosterol acetate
- Lanosta-8,24-dien-3-ol, 3-acetate, (3β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lanosteryl acetate
CAS:<p>Lanosteryl acetate is a bioactive chemical.</p>Formula:C32H52O2Color and Shape:SolidMolecular weight:468.75
