CAS 26715-00-4
:Poly(4-vinylpyridine-N-oxide)
Description:
Poly(4-vinylpyridine-N-oxide) is a synthetic polymer characterized by its unique structure, which includes pyridine rings that are functionalized with an N-oxide group. This modification enhances the polymer's solubility in polar solvents and imparts distinctive chemical properties. The polymer typically exhibits good thermal stability and can be processed into various forms, including films and fibers. Its ionic nature allows for interactions with various ions and molecules, making it useful in applications such as ion exchange, catalysis, and as a stabilizing agent in colloidal systems. Additionally, the presence of the pyridine moiety contributes to its potential as a ligand in coordination chemistry. The polymer's properties can be tailored through copolymerization or by varying the molecular weight, which influences its mechanical and thermal characteristics. Overall, Poly(4-vinylpyridine-N-oxide) is a versatile material with applications in fields ranging from materials science to pharmaceuticals.
Formula:(C7H7NO)x
InChI:InChI=1S/C7H7NO/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2
InChI key:InChIKey=KRFXUBMJBAXOOZ-UHFFFAOYSA-N
SMILES:C(=C)C=1C=CN(=O)=CC1
Synonyms:- Pyridine, 4-vinyl-, 1-oxide, polymers
- Poly(4-vinylpyridine-N-oxide)
- Pyridine, 4-ethenyl-, 1-oxide, homopolymer
- Bayer V 3504
- 4-Vinylpyridine 1-oxide polymer
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.