
CAS 26716-77-8
:1-Naphthol homopolymer
Description:
1-Naphthol homopolymer, identified by its CAS number 26716-77-8, is a polymer derived from the polymerization of 1-naphthol, a compound known for its aromatic structure and hydroxyl functional group. This homopolymer exhibits characteristics typical of aromatic polymers, including good thermal stability and resistance to chemical degradation. It is generally soluble in organic solvents and may exhibit varying degrees of crystallinity depending on its molecular weight and processing conditions. The presence of hydroxyl groups in its structure can impart hydrophilicity, influencing its interactions with water and other polar solvents. Additionally, 1-naphthol homopolymer can be utilized in various applications, including as a dye intermediate, in coatings, and as a component in plastics, due to its ability to enhance mechanical properties and provide UV stability. Its unique properties make it a subject of interest in materials science and polymer chemistry, particularly in the development of advanced materials with specific functional characteristics.
Formula:(C10H8O)x
InChI:InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H
InChI key:InChIKey=KJCVRFUGPWSIIH-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC1)C=CC=C2
Synonyms:- 1-Naphthalenol, homopolymer
- α-Naphthol polymer
- Poly-α-naphthol
- 1-Naphthol, polymers
- Poly-1-naphthol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
